C14H16N6 — CID 80900481
[6-(5,6-dimethylbenzimidazol-1-yl)-2-methylpyrimidin-4-yl]hydrazine (PubChem CID 80900481) has the molecular formula C14H16N6 and a molecular weight of 268.32 g/mol. Its IUPAC name is [6-(5,6-dimethylbenzimidazol-1-yl)-2-methylpyrimidin-4-yl]hydrazine.
| Compound Name | [6-(5,6-dimethylbenzimidazol-1-yl)-2-methylpyrimidin-4-yl]hydrazine |
|---|---|
| PubChem CID | 80900481 |
| Molecular Formula | C14H16N6 |
| Molecular Weight | 268.32 g/mol |
| Exact Mass | 268.14 |
| IUPAC Name | [6-(5,6-dimethylbenzimidazol-1-yl)-2-methylpyrimidin-4-yl]hydrazine |
| SMILES | Cc1nc(NN)cc(-n2cnc3cc(C)c(C)cc32)n1 |
| InChI | InChI=1S/C14H16N6/c1-8-4-11-12(5-9(8)2)20(7-16-11)14-6-13(19-15)17-10(3)18-14/h4-7H,15H2,1-3H3,(H,17,18,19) |
| InChIKey | YLBXQYFQWSVDML-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 81.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.32 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|