C13H15N7 — CID 80901487
4-(5,6-dimethylbenzimidazol-1-yl)-6-hydrazinylpyrimidin-2-amine (PubChem CID 80901487) has the molecular formula C13H15N7 and a molecular weight of 269.31 g/mol. Its IUPAC name is 4-(5,6-dimethylbenzimidazol-1-yl)-6-hydrazinylpyrimidin-2-amine.
| Compound Name | 4-(5,6-dimethylbenzimidazol-1-yl)-6-hydrazinylpyrimidin-2-amine |
|---|---|
| PubChem CID | 80901487 |
| Molecular Formula | C13H15N7 |
| Molecular Weight | 269.31 g/mol |
| Exact Mass | 269.14 |
| IUPAC Name | 4-(5,6-dimethylbenzimidazol-1-yl)-6-hydrazinylpyrimidin-2-amine |
| SMILES | Cc1cc2ncn(-c3cc(NN)nc(N)n3)c2cc1C |
| InChI | InChI=1S/C13H15N7/c1-7-3-9-10(4-8(7)2)20(6-16-9)12-5-11(19-15)17-13(14)18-12/h3-6H,15H2,1-2H3,(H3,14,17,18,19) |
| InChIKey | ZAKXVOLDLZFWAH-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 107.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.31 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|