C14H15FN6 — CID 80901577
N-[1-(3-fluorophenyl)ethyl]-6-hydrazinylimidazo[1,2-a]pyrazin-8-amine (PubChem CID 80901577) has the molecular formula C14H15FN6 and a molecular weight of 286.31 g/mol. Its IUPAC name is N-[1-(3-fluorophenyl)ethyl]-6-hydrazinylimidazo[1,2-a]pyrazin-8-amine.
| Compound Name | N-[1-(3-fluorophenyl)ethyl]-6-hydrazinylimidazo[1,2-a]pyrazin-8-amine |
|---|---|
| PubChem CID | 80901577 |
| Molecular Formula | C14H15FN6 |
| Molecular Weight | 286.31 g/mol |
| Exact Mass | 286.13 |
| IUPAC Name | N-[1-(3-fluorophenyl)ethyl]-6-hydrazinylimidazo[1,2-a]pyrazin-8-amine |
| SMILES | CC(Nc1nc(NN)cn2ccnc12)c1cccc(F)c1 |
| InChI | InChI=1S/C14H15FN6/c1-9(10-3-2-4-11(15)7-10)18-13-14-17-5-6-21(14)8-12(19-13)20-16/h2-9,20H,16H2,1H3,(H,18,19) |
| InChIKey | UYUIELWBJJDADZ-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 80.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.31 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|