C14H18N6S — CID 80909069
6-hydrazinyl-N-[1-(5-methylthiophen-2-yl)propan-2-yl]imidazo[1,2-a]pyrazin-8-amine (PubChem CID 80909069) has the molecular formula C14H18N6S and a molecular weight of 302.41 g/mol. Its IUPAC name is 6-hydrazinyl-N-[1-(5-methylthiophen-2-yl)propan-2-yl]imidazo[1,2-a]pyrazin-8-amine.
| Compound Name | 6-hydrazinyl-N-[1-(5-methylthiophen-2-yl)propan-2-yl]imidazo[1,2-a]pyrazin-8-amine |
|---|---|
| PubChem CID | 80909069 |
| Molecular Formula | C14H18N6S |
| Molecular Weight | 302.41 g/mol |
| Exact Mass | 302.13 |
| IUPAC Name | 6-hydrazinyl-N-[1-(5-methylthiophen-2-yl)propan-2-yl]imidazo[1,2-a]pyrazin-8-amine |
| SMILES | Cc1ccc(CC(C)Nc2nc(NN)cn3ccnc23)s1 |
| InChI | InChI=1S/C14H18N6S/c1-9(7-11-4-3-10(2)21-11)17-13-14-16-5-6-20(14)8-12(18-13)19-15/h3-6,8-9,19H,7,15H2,1-2H3,(H,17,18) |
| InChIKey | ANOJNEDRDPKQMB-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 80.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.41 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|