C11H17N7O3 — CID 80901623
1-[4-(6-hydrazinyl-5-nitropyrimidin-4-yl)-1,4-diazepan-1-yl]ethanone (PubChem CID 80901623) has the molecular formula C11H17N7O3 and a molecular weight of 295.30 g/mol. Its IUPAC name is 1-[4-(6-hydrazinyl-5-nitropyrimidin-4-yl)-1,4-diazepan-1-yl]ethanone.
| Compound Name | 1-[4-(6-hydrazinyl-5-nitropyrimidin-4-yl)-1,4-diazepan-1-yl]ethanone |
|---|---|
| PubChem CID | 80901623 |
| Molecular Formula | C11H17N7O3 |
| Molecular Weight | 295.30 g/mol |
| Exact Mass | 295.14 |
| IUPAC Name | 1-[4-(6-hydrazinyl-5-nitropyrimidin-4-yl)-1,4-diazepan-1-yl]ethanone |
| SMILES | CC(=O)N1CCCN(c2ncnc(NN)c2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C11H17N7O3/c1-8(19)16-3-2-4-17(6-5-16)11-9(18(20)21)10(15-12)13-7-14-11/h7H,2-6,12H2,1H3,(H,13,14,15) |
| InChIKey | SUJDTKSDFYNGSE-UHFFFAOYSA-N |
| XLogP | -0.27 |
| TPSA | 130.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.30 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|