C11H18N6O3 — CID 102971973
[6-(3-methoxy-4-methylpiperidin-1-yl)-5-nitropyrimidin-4-yl]hydrazine (PubChem CID 102971973) has the molecular formula C11H18N6O3 and a molecular weight of 282.30 g/mol. Its IUPAC name is [6-(3-methoxy-4-methylpiperidin-1-yl)-5-nitropyrimidin-4-yl]hydrazine.
| Compound Name | [6-(3-methoxy-4-methylpiperidin-1-yl)-5-nitropyrimidin-4-yl]hydrazine |
|---|---|
| PubChem CID | 102971973 |
| Molecular Formula | C11H18N6O3 |
| Molecular Weight | 282.30 g/mol |
| Exact Mass | 282.14 |
| IUPAC Name | [6-(3-methoxy-4-methylpiperidin-1-yl)-5-nitropyrimidin-4-yl]hydrazine |
| SMILES | COC1CN(c2ncnc(NN)c2[N+](=O)[O-])CCC1C |
| InChI | InChI=1S/C11H18N6O3/c1-7-3-4-16(5-8(7)20-2)11-9(17(18)19)10(15-12)13-6-14-11/h6-8H,3-5,12H2,1-2H3,(H,13,14,15) |
| InChIKey | BISSRRWJTPOUGB-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 119.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.30 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|