C9H11F3N8 — CID 80901888
4-hydrazinyl-N,N-dimethyl-6-[3-(trifluoromethyl)pyrazol-1-yl]-1,3,5-triazin-2-amine (PubChem CID 80901888) has the molecular formula C9H11F3N8 and a molecular weight of 288.24 g/mol. Its IUPAC name is 4-hydrazinyl-N,N-dimethyl-6-[3-(trifluoromethyl)pyrazol-1-yl]-1,3,5-triazin-2-amine.
| Compound Name | 4-hydrazinyl-N,N-dimethyl-6-[3-(trifluoromethyl)pyrazol-1-yl]-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 80901888 |
| Molecular Formula | C9H11F3N8 |
| Molecular Weight | 288.24 g/mol |
| Exact Mass | 288.11 |
| IUPAC Name | 4-hydrazinyl-N,N-dimethyl-6-[3-(trifluoromethyl)pyrazol-1-yl]-1,3,5-triazin-2-amine |
| SMILES | CN(C)c1nc(NN)nc(-n2ccc(C(F)(F)F)n2)n1 |
| InChI | InChI=1S/C9H11F3N8/c1-19(2)7-14-6(17-13)15-8(16-7)20-4-3-5(18-20)9(10,11)12/h3-4H,13H2,1-2H3,(H,14,15,16,17) |
| InChIKey | RMPSXOOWFNADQJ-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 97.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.24 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|