C11H21N5 — CID 80903777
N-(2,2-dimethylpropyl)-2-hydrazinyl-N,6-dimethylpyrimidin-4-amine (PubChem CID 80903777) has the molecular formula C11H21N5 and a molecular weight of 223.32 g/mol. Its IUPAC name is N-(2,2-dimethylpropyl)-2-hydrazinyl-N,6-dimethylpyrimidin-4-amine.
| Compound Name | N-(2,2-dimethylpropyl)-2-hydrazinyl-N,6-dimethylpyrimidin-4-amine |
|---|---|
| PubChem CID | 80903777 |
| Molecular Formula | C11H21N5 |
| Molecular Weight | 223.32 g/mol |
| Exact Mass | 223.18 |
| IUPAC Name | N-(2,2-dimethylpropyl)-2-hydrazinyl-N,6-dimethylpyrimidin-4-amine |
| SMILES | Cc1cc(N(C)CC(C)(C)C)nc(NN)n1 |
| InChI | InChI=1S/C11H21N5/c1-8-6-9(14-10(13-8)15-12)16(5)7-11(2,3)4/h6H,7,12H2,1-5H3,(H,13,14,15) |
| InChIKey | YUSUVAOVLIDRHH-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 67.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.32 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|