C9H17N5O — CID 80896244
2-hydrazinyl-N-(2-methoxyethyl)-N,6-dimethylpyrimidin-4-amine (PubChem CID 80896244) has the molecular formula C9H17N5O and a molecular weight of 211.27 g/mol. Its IUPAC name is 2-hydrazinyl-N-(2-methoxyethyl)-N,6-dimethylpyrimidin-4-amine.
| Compound Name | 2-hydrazinyl-N-(2-methoxyethyl)-N,6-dimethylpyrimidin-4-amine |
|---|---|
| PubChem CID | 80896244 |
| Molecular Formula | C9H17N5O |
| Molecular Weight | 211.27 g/mol |
| Exact Mass | 211.14 |
| IUPAC Name | 2-hydrazinyl-N-(2-methoxyethyl)-N,6-dimethylpyrimidin-4-amine |
| SMILES | COCCN(C)c1cc(C)nc(NN)n1 |
| InChI | InChI=1S/C9H17N5O/c1-7-6-8(12-9(11-7)13-10)14(2)4-5-15-3/h6H,4-5,10H2,1-3H3,(H,11,12,13) |
| InChIKey | BAOIGKNAJDHNMI-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 76.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.27 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|