C9H14N6 — CID 80916985
3-[(2-hydrazinyl-6-methylpyrimidin-4-yl)-methylamino]propanenitrile (PubChem CID 80916985) has the molecular formula C9H14N6 and a molecular weight of 206.25 g/mol. Its IUPAC name is 3-[(2-hydrazinyl-6-methylpyrimidin-4-yl)-methylamino]propanenitrile.
| Compound Name | 3-[(2-hydrazinyl-6-methylpyrimidin-4-yl)-methylamino]propanenitrile |
|---|---|
| PubChem CID | 80916985 |
| Molecular Formula | C9H14N6 |
| Molecular Weight | 206.25 g/mol |
| Exact Mass | 206.13 |
| IUPAC Name | 3-[(2-hydrazinyl-6-methylpyrimidin-4-yl)-methylamino]propanenitrile |
| SMILES | Cc1cc(N(C)CCC#N)nc(NN)n1 |
| InChI | InChI=1S/C9H14N6/c1-7-6-8(13-9(12-7)14-11)15(2)5-3-4-10/h6H,3,5,11H2,1-2H3,(H,12,13,14) |
| InChIKey | KIEKUDHWFZQJCY-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 90.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.25 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|