C11H21N5O — CID 80909371
N-(2-ethoxyethyl)-N-ethyl-2-hydrazinyl-6-methylpyrimidin-4-amine (PubChem CID 80909371) has the molecular formula C11H21N5O and a molecular weight of 239.32 g/mol. Its IUPAC name is N-(2-ethoxyethyl)-N-ethyl-2-hydrazinyl-6-methylpyrimidin-4-amine.
| Compound Name | N-(2-ethoxyethyl)-N-ethyl-2-hydrazinyl-6-methylpyrimidin-4-amine |
|---|---|
| PubChem CID | 80909371 |
| Molecular Formula | C11H21N5O |
| Molecular Weight | 239.32 g/mol |
| Exact Mass | 239.17 |
| IUPAC Name | N-(2-ethoxyethyl)-N-ethyl-2-hydrazinyl-6-methylpyrimidin-4-amine |
| SMILES | CCOCCN(CC)c1cc(C)nc(NN)n1 |
| InChI | InChI=1S/C11H21N5O/c1-4-16(6-7-17-5-2)10-8-9(3)13-11(14-10)15-12/h8H,4-7,12H2,1-3H3,(H,13,14,15) |
| InChIKey | BBZDVMXOHISCML-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 76.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.32 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|