C12H17N7 — CID 80905178
3-[(6-hydrazinylimidazo[1,2-a]pyrazin-8-yl)-propan-2-ylamino]propanenitrile (PubChem CID 80905178) has the molecular formula C12H17N7 and a molecular weight of 259.32 g/mol. Its IUPAC name is 3-[(6-hydrazinylimidazo[1,2-a]pyrazin-8-yl)-propan-2-ylamino]propanenitrile.
| Compound Name | 3-[(6-hydrazinylimidazo[1,2-a]pyrazin-8-yl)-propan-2-ylamino]propanenitrile |
|---|---|
| PubChem CID | 80905178 |
| Molecular Formula | C12H17N7 |
| Molecular Weight | 259.32 g/mol |
| Exact Mass | 259.15 |
| IUPAC Name | 3-[(6-hydrazinylimidazo[1,2-a]pyrazin-8-yl)-propan-2-ylamino]propanenitrile |
| SMILES | CC(C)N(CCC#N)c1nc(NN)cn2ccnc12 |
| InChI | InChI=1S/C12H17N7/c1-9(2)19(6-3-4-13)12-11-15-5-7-18(11)8-10(16-12)17-14/h5,7-9,17H,3,6,14H2,1-2H3 |
| InChIKey | MIIDNXDAXDULEF-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 95.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.32 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|