C13H24N6 — CID 80909718
[6-(3-ethyl-4-methylpiperazin-1-yl)-2,5-dimethylpyrimidin-4-yl]hydrazine (PubChem CID 80909718) has the molecular formula C13H24N6 and a molecular weight of 264.38 g/mol. Its IUPAC name is [6-(3-ethyl-4-methylpiperazin-1-yl)-2,5-dimethylpyrimidin-4-yl]hydrazine.
| Compound Name | [6-(3-ethyl-4-methylpiperazin-1-yl)-2,5-dimethylpyrimidin-4-yl]hydrazine |
|---|---|
| PubChem CID | 80909718 |
| Molecular Formula | C13H24N6 |
| Molecular Weight | 264.38 g/mol |
| Exact Mass | 264.21 |
| IUPAC Name | [6-(3-ethyl-4-methylpiperazin-1-yl)-2,5-dimethylpyrimidin-4-yl]hydrazine |
| SMILES | CCC1CN(c2nc(C)nc(NN)c2C)CCN1C |
| InChI | InChI=1S/C13H24N6/c1-5-11-8-19(7-6-18(11)4)13-9(2)12(17-14)15-10(3)16-13/h11H,5-8,14H2,1-4H3,(H,15,16,17) |
| InChIKey | KBYGIRWDHLMHGQ-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 70.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.38 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|