C14H24N6 — CID 80914467
[6-(1,3,4,5,7,8,9,9a-octahydropyrrolo[1,2-a][1,4]diazepin-2-yl)-2,5-dimethylpyrimidin-4-yl]hydrazine (PubChem CID 80914467) has the molecular formula C14H24N6 and a molecular weight of 276.39 g/mol. Its IUPAC name is [6-(1,3,4,5,7,8,9,9a-octahydropyrrolo[1,2-a][1,4]diazepin-2-yl)-2,5-dimethylpyrimidin-4-yl]hydrazine.
| Compound Name | [6-(1,3,4,5,7,8,9,9a-octahydropyrrolo[1,2-a][1,4]diazepin-2-yl)-2,5-dimethylpyrimidin-4-yl]hydrazine |
|---|---|
| PubChem CID | 80914467 |
| Molecular Formula | C14H24N6 |
| Molecular Weight | 276.39 g/mol |
| Exact Mass | 276.21 |
| IUPAC Name | [6-(1,3,4,5,7,8,9,9a-octahydropyrrolo[1,2-a][1,4]diazepin-2-yl)-2,5-dimethylpyrimidin-4-yl]hydrazine |
| SMILES | Cc1nc(NN)c(C)c(N2CCCN3CCCC3C2)n1 |
| InChI | InChI=1S/C14H24N6/c1-10-13(18-15)16-11(2)17-14(10)20-8-4-7-19-6-3-5-12(19)9-20/h12H,3-9,15H2,1-2H3,(H,16,17,18) |
| InChIKey | JSDGFEJYUGVGMP-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 70.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.39 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|