C13H22N6 — CID 80928966
[6-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-2,5-dimethylpyrimidin-4-yl]hydrazine (PubChem CID 80928966) has the molecular formula C13H22N6 and a molecular weight of 262.36 g/mol. Its IUPAC name is [6-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-2,5-dimethylpyrimidin-4-yl]hydrazine.
| Compound Name | [6-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-2,5-dimethylpyrimidin-4-yl]hydrazine |
|---|---|
| PubChem CID | 80928966 |
| Molecular Formula | C13H22N6 |
| Molecular Weight | 262.36 g/mol |
| Exact Mass | 262.19 |
| IUPAC Name | [6-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-2,5-dimethylpyrimidin-4-yl]hydrazine |
| SMILES | Cc1nc(NN)c(C)c(N2CCN3CCCC3C2)n1 |
| InChI | InChI=1S/C13H22N6/c1-9-12(17-14)15-10(2)16-13(9)19-7-6-18-5-3-4-11(18)8-19/h11H,3-8,14H2,1-2H3,(H,15,16,17) |
| InChIKey | PDDDKICWQREFCI-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 70.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.36 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|