C9H14N4O2 — CID 80911477
[6-(oxolan-2-ylmethoxy)pyrimidin-4-yl]hydrazine (PubChem CID 80911477) has the molecular formula C9H14N4O2 and a molecular weight of 210.24 g/mol. Its IUPAC name is [6-(oxolan-2-ylmethoxy)pyrimidin-4-yl]hydrazine.
| Compound Name | [6-(oxolan-2-ylmethoxy)pyrimidin-4-yl]hydrazine |
|---|---|
| PubChem CID | 80911477 |
| Molecular Formula | C9H14N4O2 |
| Molecular Weight | 210.24 g/mol |
| Exact Mass | 210.11 |
| IUPAC Name | [6-(oxolan-2-ylmethoxy)pyrimidin-4-yl]hydrazine |
| SMILES | NNc1cc(OCC2CCCO2)ncn1 |
| InChI | InChI=1S/C9H14N4O2/c10-13-8-4-9(12-6-11-8)15-5-7-2-1-3-14-7/h4,6-7H,1-3,5,10H2,(H,11,12,13) |
| InChIKey | AFZMVYPEKDVREZ-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 82.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.24 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|