C9H16N6 — CID 80917500
(4-methyl-6-piperazin-1-ylpyrimidin-2-yl)hydrazine (PubChem CID 80917500) has the molecular formula C9H16N6 and a molecular weight of 208.27 g/mol. Its IUPAC name is (4-methyl-6-piperazin-1-ylpyrimidin-2-yl)hydrazine.
| Compound Name | (4-methyl-6-piperazin-1-ylpyrimidin-2-yl)hydrazine |
|---|---|
| PubChem CID | 80917500 |
| Molecular Formula | C9H16N6 |
| Molecular Weight | 208.27 g/mol |
| Exact Mass | 208.14 |
| IUPAC Name | (4-methyl-6-piperazin-1-ylpyrimidin-2-yl)hydrazine |
| SMILES | Cc1cc(N2CCNCC2)nc(NN)n1 |
| InChI | InChI=1S/C9H16N6/c1-7-6-8(13-9(12-7)14-10)15-4-2-11-3-5-15/h6,11H,2-5,10H2,1H3,(H,12,13,14) |
| InChIKey | KKRGSSLXLRTIQZ-UHFFFAOYSA-N |
| XLogP | -0.52 |
| TPSA | 79.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.27 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|