C8H16N8 — CID 23198073
(2-hydrazinyl-6-piperazin-1-ylpyrimidin-4-yl)hydrazine (PubChem CID 23198073) has the molecular formula C8H16N8 and a molecular weight of 224.27 g/mol. Its IUPAC name is (2-hydrazinyl-6-piperazin-1-ylpyrimidin-4-yl)hydrazine.
| Compound Name | (2-hydrazinyl-6-piperazin-1-ylpyrimidin-4-yl)hydrazine |
|---|---|
| PubChem CID | 23198073 |
| Molecular Formula | C8H16N8 |
| Molecular Weight | 224.27 g/mol |
| Exact Mass | 224.15 |
| IUPAC Name | (2-hydrazinyl-6-piperazin-1-ylpyrimidin-4-yl)hydrazine |
| SMILES | NNc1cc(N2CCNCC2)nc(NN)n1 |
| InChI | InChI=1S/C8H16N8/c9-14-6-5-7(13-8(12-6)15-10)16-3-1-11-2-4-16/h5,11H,1-4,9-10H2,(H2,12,13,14,15) |
| InChIKey | IDZHLWGLIZZTBF-UHFFFAOYSA-N |
| XLogP | -1.54 |
| TPSA | 117.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.27 |
| LogP ≤ 5 | -1.54 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|