C14H15F3N4 — CID 80956479
6-N-methyl-2-propan-2-yl-4-N-(2,3,4-trifluorophenyl)pyrimidine-4,6-diamine (PubChem CID 80956479) has the molecular formula C14H15F3N4 and a molecular weight of 296.30 g/mol. Its IUPAC name is 6-N-methyl-2-propan-2-yl-4-N-(2,3,4-trifluorophenyl)pyrimidine-4,6-diamine.
| Compound Name | 6-N-methyl-2-propan-2-yl-4-N-(2,3,4-trifluorophenyl)pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 80956479 |
| Molecular Formula | C14H15F3N4 |
| Molecular Weight | 296.30 g/mol |
| Exact Mass | 296.12 |
| IUPAC Name | 6-N-methyl-2-propan-2-yl-4-N-(2,3,4-trifluorophenyl)pyrimidine-4,6-diamine |
| SMILES | CNc1cc(Nc2ccc(F)c(F)c2F)nc(C(C)C)n1 |
| InChI | InChI=1S/C14H15F3N4/c1-7(2)14-20-10(18-3)6-11(21-14)19-9-5-4-8(15)12(16)13(9)17/h4-7H,1-3H3,(H2,18,19,20,21) |
| InChIKey | CYGUOPSLTONXAJ-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.30 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|