C13H11Br2F2N3 — CID 107614831
6-bromo-N-(4-bromo-2,5-difluorophenyl)-2-propan-2-ylpyrimidin-4-amine (PubChem CID 107614831) has the molecular formula C13H11Br2F2N3 and a molecular weight of 407.06 g/mol. Its IUPAC name is 6-bromo-N-(4-bromo-2,5-difluorophenyl)-2-propan-2-ylpyrimidin-4-amine.
| Compound Name | 6-bromo-N-(4-bromo-2,5-difluorophenyl)-2-propan-2-ylpyrimidin-4-amine |
|---|---|
| PubChem CID | 107614831 |
| Molecular Formula | C13H11Br2F2N3 |
| Molecular Weight | 407.06 g/mol |
| Exact Mass | 404.93 |
| IUPAC Name | 6-bromo-N-(4-bromo-2,5-difluorophenyl)-2-propan-2-ylpyrimidin-4-amine |
| SMILES | CC(C)c1nc(Br)cc(Nc2cc(F)c(Br)cc2F)n1 |
| InChI | InChI=1S/C13H11Br2F2N3/c1-6(2)13-19-11(15)5-12(20-13)18-10-4-8(16)7(14)3-9(10)17/h3-6H,1-2H3,(H,18,19,20) |
| InChIKey | SNQFEOJRLLTABD-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.06 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|