C16H25N5 — CID 80958405
6-(4-cyclopentylpiperazin-1-yl)-2-cyclopropylpyrimidin-4-amine (PubChem CID 80958405) has the molecular formula C16H25N5 and a molecular weight of 287.41 g/mol. Its IUPAC name is 6-(4-cyclopentylpiperazin-1-yl)-2-cyclopropylpyrimidin-4-amine.
| Compound Name | 6-(4-cyclopentylpiperazin-1-yl)-2-cyclopropylpyrimidin-4-amine |
|---|---|
| PubChem CID | 80958405 |
| Molecular Formula | C16H25N5 |
| Molecular Weight | 287.41 g/mol |
| Exact Mass | 287.21 |
| IUPAC Name | 6-(4-cyclopentylpiperazin-1-yl)-2-cyclopropylpyrimidin-4-amine |
| SMILES | Nc1cc(N2CCN(C3CCCC3)CC2)nc(C2CC2)n1 |
| InChI | InChI=1S/C16H25N5/c17-14-11-15(19-16(18-14)12-5-6-12)21-9-7-20(8-10-21)13-3-1-2-4-13/h11-13H,1-10H2,(H2,17,18,19) |
| InChIKey | YQXYIVHTMCMRBL-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.41 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |