C16H29N5 — CID 80968908
N-(4,4-dimethylcyclohexyl)-6-hydrazinyl-N-methyl-2-propan-2-ylpyrimidin-4-amine (PubChem CID 80968908) has the molecular formula C16H29N5 and a molecular weight of 291.44 g/mol. Its IUPAC name is N-(4,4-dimethylcyclohexyl)-6-hydrazinyl-N-methyl-2-propan-2-ylpyrimidin-4-amine.
| Compound Name | N-(4,4-dimethylcyclohexyl)-6-hydrazinyl-N-methyl-2-propan-2-ylpyrimidin-4-amine |
|---|---|
| PubChem CID | 80968908 |
| Molecular Formula | C16H29N5 |
| Molecular Weight | 291.44 g/mol |
| Exact Mass | 291.24 |
| IUPAC Name | N-(4,4-dimethylcyclohexyl)-6-hydrazinyl-N-methyl-2-propan-2-ylpyrimidin-4-amine |
| SMILES | CC(C)c1nc(NN)cc(N(C)C2CCC(C)(C)CC2)n1 |
| InChI | InChI=1S/C16H29N5/c1-11(2)15-18-13(20-17)10-14(19-15)21(5)12-6-8-16(3,4)9-7-12/h10-12H,6-9,17H2,1-5H3,(H,18,19,20) |
| InChIKey | SGWQRJFBOLGYGM-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 67.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.44 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|