C10H24N2 — CID 8097
N,N,N',N'-tetramethylhexane-1,6-diamine (PubChem CID 8097) has the molecular formula C10H24N2 and a molecular weight of 172.32 g/mol. Its IUPAC name is N,N,N',N'-tetramethylhexane-1,6-diamine.
| Compound Name | N,N,N',N'-tetramethylhexane-1,6-diamine |
|---|---|
| PubChem CID | 8097 |
| Molecular Formula | C10H24N2 |
| Molecular Weight | 172.32 g/mol |
| Exact Mass | 172.19 |
| IUPAC Name | N,N,N',N'-tetramethylhexane-1,6-diamine |
| SMILES | CN(C)CCCCCCN(C)C |
| InChI | InChI=1S/C10H24N2/c1-11(2)9-7-5-6-8-10-12(3)4/h5-10H2,1-4H3 |
| InChIKey | TXXWBTOATXBWDR-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.32 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|