About Triamylamine
Triamylamine (PubChem CID 12133) has the molecular formula C15H33N
and a molecular weight of 227.43 g/mol. Its IUPAC name is N,N-dipentylpentan-1-amine.
Molecular Properties
| Compound Name | Triamylamine |
| PubChem CID | 12133 |
| Molecular Formula | C15H33N |
| Molecular Weight | 227.43 g/mol |
| Exact Mass | 227.26 |
| IUPAC Name | N,N-dipentylpentan-1-amine |
| SMILES | CCCCCN(CCCCC)CCCCC |
| InChI | InChI=1S/C15H33N/c1-4-7-10-13-16(14-11-8-5-2)15-12-9-6-3/h4-15H2,1-3H3 |
| InChIKey | OOHAUGDGCWURIT-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 3.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 16 |
| Complexity | 98 |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 227.43 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze Triamylamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Triamylamine?
The IUPAC name of Triamylamine (CID 12133) is N,N-dipentylpentan-1-amine.
What is the SMILES notation for Triamylamine?
The canonical SMILES for Triamylamine is CCCCCN(CCCCC)CCCCC.
What is the InChIKey of Triamylamine?
The InChIKey is OOHAUGDGCWURIT-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H33N/c1-4-7-10-13-16(14-11-8-5-2)15-12-9-6-3/h4-15H2,1-3H3.
What are the key properties of Triamylamine?
Triamylamine has a molecular weight of 227.43 g/mol, XLogP of 5.60, 12 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for Triamylamine is sourced from PubChem (CID 12133), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).