C15H20ClN3S — CID 80972406
2-tert-butyl-6-chloro-5-methyl-N-[(5-methylthiophen-2-yl)methyl]pyrimidin-4-amine (PubChem CID 80972406) has the molecular formula C15H20ClN3S and a molecular weight of 309.87 g/mol. Its IUPAC name is 2-tert-butyl-6-chloro-5-methyl-N-[(5-methylthiophen-2-yl)methyl]pyrimidin-4-amine.
| Compound Name | 2-tert-butyl-6-chloro-5-methyl-N-[(5-methylthiophen-2-yl)methyl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 80972406 |
| Molecular Formula | C15H20ClN3S |
| Molecular Weight | 309.87 g/mol |
| Exact Mass | 309.11 |
| IUPAC Name | 2-tert-butyl-6-chloro-5-methyl-N-[(5-methylthiophen-2-yl)methyl]pyrimidin-4-amine |
| SMILES | Cc1ccc(CNc2nc(C(C)(C)C)nc(Cl)c2C)s1 |
| InChI | InChI=1S/C15H20ClN3S/c1-9-6-7-11(20-9)8-17-13-10(2)12(16)18-14(19-13)15(3,4)5/h6-7H,8H2,1-5H3,(H,17,18,19) |
| InChIKey | LKOHHUIXQZXWSN-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.87 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |