C13H13Cl2N3S — CID 80978050
6-chloro-N-[(5-chlorothiophen-2-yl)methyl]-2-cyclopropyl-5-methylpyrimidin-4-amine (PubChem CID 80978050) has the molecular formula C13H13Cl2N3S and a molecular weight of 314.24 g/mol. Its IUPAC name is 6-chloro-N-[(5-chlorothiophen-2-yl)methyl]-2-cyclopropyl-5-methylpyrimidin-4-amine.
| Compound Name | 6-chloro-N-[(5-chlorothiophen-2-yl)methyl]-2-cyclopropyl-5-methylpyrimidin-4-amine |
|---|---|
| PubChem CID | 80978050 |
| Molecular Formula | C13H13Cl2N3S |
| Molecular Weight | 314.24 g/mol |
| Exact Mass | 313.02 |
| IUPAC Name | 6-chloro-N-[(5-chlorothiophen-2-yl)methyl]-2-cyclopropyl-5-methylpyrimidin-4-amine |
| SMILES | Cc1c(Cl)nc(C2CC2)nc1NCc1ccc(Cl)s1 |
| InChI | InChI=1S/C13H13Cl2N3S/c1-7-11(15)17-13(8-2-3-8)18-12(7)16-6-9-4-5-10(14)19-9/h4-5,8H,2-3,6H2,1H3,(H,16,17,18) |
| InChIKey | NVDQYXCLKIVHAF-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.24 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |