C13H17ClN4O2 — CID 80977980
3-[(6-chloro-5-methyl-2-propylpyrimidin-4-yl)amino]piperidine-2,6-dione (PubChem CID 80977980) has the molecular formula C13H17ClN4O2 and a molecular weight of 296.76 g/mol. Its IUPAC name is 3-[(6-chloro-5-methyl-2-propylpyrimidin-4-yl)amino]piperidine-2,6-dione.
| Compound Name | 3-[(6-chloro-5-methyl-2-propylpyrimidin-4-yl)amino]piperidine-2,6-dione |
|---|---|
| PubChem CID | 80977980 |
| Molecular Formula | C13H17ClN4O2 |
| Molecular Weight | 296.76 g/mol |
| Exact Mass | 296.10 |
| IUPAC Name | 3-[(6-chloro-5-methyl-2-propylpyrimidin-4-yl)amino]piperidine-2,6-dione |
| SMILES | CCCc1nc(Cl)c(C)c(NC2CCC(=O)NC2=O)n1 |
| InChI | InChI=1S/C13H17ClN4O2/c1-3-4-9-16-11(14)7(2)12(17-9)15-8-5-6-10(19)18-13(8)20/h8H,3-6H2,1-2H3,(H,15,16,17)(H,18,19,20) |
| InChIKey | CBRFHFFRUYHVCY-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.76 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|