C11H15F4N3O — CID 80988803
5-methyl-2-propyl-6-(2,2,3,3-tetrafluoropropoxy)pyrimidin-4-amine (PubChem CID 80988803) has the molecular formula C11H15F4N3O and a molecular weight of 281.25 g/mol. Its IUPAC name is 5-methyl-2-propyl-6-(2,2,3,3-tetrafluoropropoxy)pyrimidin-4-amine.
| Compound Name | 5-methyl-2-propyl-6-(2,2,3,3-tetrafluoropropoxy)pyrimidin-4-amine |
|---|---|
| PubChem CID | 80988803 |
| Molecular Formula | C11H15F4N3O |
| Molecular Weight | 281.25 g/mol |
| Exact Mass | 281.12 |
| IUPAC Name | 5-methyl-2-propyl-6-(2,2,3,3-tetrafluoropropoxy)pyrimidin-4-amine |
| SMILES | CCCc1nc(N)c(C)c(OCC(F)(F)C(F)F)n1 |
| InChI | InChI=1S/C11H15F4N3O/c1-3-4-7-17-8(16)6(2)9(18-7)19-5-11(14,15)10(12)13/h10H,3-5H2,1-2H3,(H2,16,17,18) |
| InChIKey | RGDVQERTGKIWDQ-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.25 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|