C12H16N6O — CID 80989030
1-[2-ethyl-5-methyl-6-(methylamino)pyrimidin-4-yl]pyrazole-4-carboxamide (PubChem CID 80989030) has the molecular formula C12H16N6O and a molecular weight of 260.30 g/mol. Its IUPAC name is 1-[2-ethyl-5-methyl-6-(methylamino)pyrimidin-4-yl]pyrazole-4-carboxamide.
| Compound Name | 1-[2-ethyl-5-methyl-6-(methylamino)pyrimidin-4-yl]pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 80989030 |
| Molecular Formula | C12H16N6O |
| Molecular Weight | 260.30 g/mol |
| Exact Mass | 260.14 |
| IUPAC Name | 1-[2-ethyl-5-methyl-6-(methylamino)pyrimidin-4-yl]pyrazole-4-carboxamide |
| SMILES | CCc1nc(NC)c(C)c(-n2cc(C(N)=O)cn2)n1 |
| InChI | InChI=1S/C12H16N6O/c1-4-9-16-11(14-3)7(2)12(17-9)18-6-8(5-15-18)10(13)19/h5-6H,4H2,1-3H3,(H2,13,19)(H,14,16,17) |
| InChIKey | ONUCYXUOHPCWSN-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 98.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.30 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |