C10H14F3NO2 — CID 80996437
2-[[bis(prop-2-enyl)amino]methyl]-3,3,3-trifluoropropanoic acid (PubChem CID 80996437) has the molecular formula C10H14F3NO2 and a molecular weight of 237.22 g/mol. Its IUPAC name is 2-[[bis(prop-2-enyl)amino]methyl]-3,3,3-trifluoropropanoic acid.
| Compound Name | 2-[[bis(prop-2-enyl)amino]methyl]-3,3,3-trifluoropropanoic acid |
|---|---|
| PubChem CID | 80996437 |
| Molecular Formula | C10H14F3NO2 |
| Molecular Weight | 237.22 g/mol |
| Exact Mass | 237.10 |
| IUPAC Name | 2-[[bis(prop-2-enyl)amino]methyl]-3,3,3-trifluoropropanoic acid |
| SMILES | C=CCN(CC=C)CC(C(=O)O)C(F)(F)F |
| InChI | InChI=1S/C10H14F3NO2/c1-3-5-14(6-4-2)7-8(9(15)16)10(11,12)13/h3-4,8H,1-2,5-7H2,(H,15,16) |
| InChIKey | NZPVEHJXHDQYLN-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.22 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|