2-[[bis(prop-2-enyl)amino]methyl]-3,3,3-trifluoropropanoic acid

C10H14F3NO2 — CID 80996437

IUPAC2-[[bis(prop-2-enyl)amino]methyl]-3,3,3-trifluoropropanoic acid
SMILESC=CCN(CC=C)CC(C(=O)O)C(F)(F)F
InChIInChI=1S/C10H14F3NO2/c1-3-5-14(6-4-2)7-8(9(15)16)10(11,12)13/h3-4,8H,1-2,5-7H2,(H,15,16)
InChIKeyNZPVEHJXHDQYLN-UHFFFAOYSA-N
MW237.22 g/mol
LogP1.92
Rot. Bonds7

About 2-[[bis(prop-2-enyl)amino]methyl]-3,3,3-trifluoropropanoic acid

2-[[bis(prop-2-enyl)amino]methyl]-3,3,3-trifluoropropanoic acid (PubChem CID 80996437) has the molecular formula C10H14F3NO2 and a molecular weight of 237.22 g/mol. Its IUPAC name is 2-[[bis(prop-2-enyl)amino]methyl]-3,3,3-trifluoropropanoic acid.

Molecular Properties

Compound Name2-[[bis(prop-2-enyl)amino]methyl]-3,3,3-trifluoropropanoic acid
PubChem CID80996437
Molecular FormulaC10H14F3NO2
Molecular Weight237.22 g/mol
Exact Mass237.10
IUPAC Name2-[[bis(prop-2-enyl)amino]methyl]-3,3,3-trifluoropropanoic acid
SMILESC=CCN(CC=C)CC(C(=O)O)C(F)(F)F
InChIInChI=1S/C10H14F3NO2/c1-3-5-14(6-4-2)7-8(9(15)16)10(11,12)13/h3-4,8H,1-2,5-7H2,(H,15,16)
InChIKeyNZPVEHJXHDQYLN-UHFFFAOYSA-N
XLogP1.92
TPSA40.54 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds7
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500237.22
LogP ≤ 51.92
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'isolated_alkene', 'substructure': 'N/A'}

Analyze 2-[[bis(prop-2-enyl)amino]methyl]-3,3,3-trifluoropropanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[[bis(prop-2-enyl)amino]methyl]-3,3,3-trifluoropropanoic acid?
The IUPAC name of 2-[[bis(prop-2-enyl)amino]methyl]-3,3,3-trifluoropropanoic acid (CID 80996437) is 2-[[bis(prop-2-enyl)amino]methyl]-3,3,3-trifluoropropanoic acid.
What is the SMILES notation for 2-[[bis(prop-2-enyl)amino]methyl]-3,3,3-trifluoropropanoic acid?
The canonical SMILES for 2-[[bis(prop-2-enyl)amino]methyl]-3,3,3-trifluoropropanoic acid is C=CCN(CC=C)CC(C(=O)O)C(F)(F)F.
What is the InChIKey of 2-[[bis(prop-2-enyl)amino]methyl]-3,3,3-trifluoropropanoic acid?
The InChIKey is NZPVEHJXHDQYLN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14F3NO2/c1-3-5-14(6-4-2)7-8(9(15)16)10(11,12)13/h3-4,8H,1-2,5-7H2,(H,15,16).
What are the key properties of 2-[[bis(prop-2-enyl)amino]methyl]-3,3,3-trifluoropropanoic acid?
2-[[bis(prop-2-enyl)amino]methyl]-3,3,3-trifluoropropanoic acid has a molecular weight of 237.22 g/mol, XLogP of 1.92, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[bis(prop-2-enyl)amino]methyl]-3,3,3-trifluoropropanoic acid is sourced from PubChem (CID 80996437), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).