C12H24N2 — CID 80997690
N-ethyl-2-(methylaminomethyl)-N-(2-methylprop-2-enyl)cyclobutan-1-amine (PubChem CID 80997690) has the molecular formula C12H24N2 and a molecular weight of 196.34 g/mol. Its IUPAC name is N-ethyl-2-(methylaminomethyl)-N-(2-methylprop-2-enyl)cyclobutan-1-amine.
| Compound Name | N-ethyl-2-(methylaminomethyl)-N-(2-methylprop-2-enyl)cyclobutan-1-amine |
|---|---|
| PubChem CID | 80997690 |
| Molecular Formula | C12H24N2 |
| Molecular Weight | 196.34 g/mol |
| Exact Mass | 196.19 |
| IUPAC Name | N-ethyl-2-(methylaminomethyl)-N-(2-methylprop-2-enyl)cyclobutan-1-amine |
| SMILES | C=C(C)CN(CC)C1CCC1CNC |
| InChI | InChI=1S/C12H24N2/c1-5-14(9-10(2)3)12-7-6-11(12)8-13-4/h11-13H,2,5-9H2,1,3-4H3 |
| InChIKey | UATXIVYOXLZQOV-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.34 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|