C10H22N2O2S — CID 81005332
N-methyl-2-(methylaminomethyl)-N-(2-methylsulfonylethyl)cyclobutan-1-amine (PubChem CID 81005332) has the molecular formula C10H22N2O2S and a molecular weight of 234.36 g/mol. Its IUPAC name is N-methyl-2-(methylaminomethyl)-N-(2-methylsulfonylethyl)cyclobutan-1-amine.
| Compound Name | N-methyl-2-(methylaminomethyl)-N-(2-methylsulfonylethyl)cyclobutan-1-amine |
|---|---|
| PubChem CID | 81005332 |
| Molecular Formula | C10H22N2O2S |
| Molecular Weight | 234.36 g/mol |
| Exact Mass | 234.14 |
| IUPAC Name | N-methyl-2-(methylaminomethyl)-N-(2-methylsulfonylethyl)cyclobutan-1-amine |
| SMILES | CNCC1CCC1N(C)CCS(C)(=O)=O |
| InChI | InChI=1S/C10H22N2O2S/c1-11-8-9-4-5-10(9)12(2)6-7-15(3,13)14/h9-11H,4-8H2,1-3H3 |
| InChIKey | GFEOCNQYYSALHL-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.36 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |