C14H28N2O2S2 — CID 81004535
2-methyl-N-[[2-(3-methylsulfonylthiomorpholin-4-yl)cyclobutyl]methyl]propan-1-amine (PubChem CID 81004535) has the molecular formula C14H28N2O2S2 and a molecular weight of 320.52 g/mol. Its IUPAC name is 2-methyl-N-[[2-(3-methylsulfonylthiomorpholin-4-yl)cyclobutyl]methyl]propan-1-amine.
| Compound Name | 2-methyl-N-[[2-(3-methylsulfonylthiomorpholin-4-yl)cyclobutyl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 81004535 |
| Molecular Formula | C14H28N2O2S2 |
| Molecular Weight | 320.52 g/mol |
| Exact Mass | 320.16 |
| IUPAC Name | 2-methyl-N-[[2-(3-methylsulfonylthiomorpholin-4-yl)cyclobutyl]methyl]propan-1-amine |
| SMILES | CC(C)CNCC1CCC1N1CCSCC1S(C)(=O)=O |
| InChI | InChI=1S/C14H28N2O2S2/c1-11(2)8-15-9-12-4-5-13(12)16-6-7-19-10-14(16)20(3,17)18/h11-15H,4-10H2,1-3H3 |
| InChIKey | FBXGEAQMMPCIFI-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.52 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |