C10H20N2O2S2 — CID 81004713
[2-(3-methylsulfonylthiomorpholin-4-yl)cyclobutyl]methanamine (PubChem CID 81004713) has the molecular formula C10H20N2O2S2 and a molecular weight of 264.42 g/mol. Its IUPAC name is [2-(3-methylsulfonylthiomorpholin-4-yl)cyclobutyl]methanamine.
| Compound Name | [2-(3-methylsulfonylthiomorpholin-4-yl)cyclobutyl]methanamine |
|---|---|
| PubChem CID | 81004713 |
| Molecular Formula | C10H20N2O2S2 |
| Molecular Weight | 264.42 g/mol |
| Exact Mass | 264.10 |
| IUPAC Name | [2-(3-methylsulfonylthiomorpholin-4-yl)cyclobutyl]methanamine |
| SMILES | CS(=O)(=O)C1CSCCN1C1CCC1CN |
| InChI | InChI=1S/C10H20N2O2S2/c1-16(13,14)10-7-15-5-4-12(10)9-3-2-8(9)6-11/h8-10H,2-7,11H2,1H3 |
| InChIKey | UMUSBPJNMZSITB-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.42 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |