C10H17NO3S2 — CID 79644116
3-(3-methylsulfonylthiomorpholin-4-yl)cyclopentan-1-one (PubChem CID 79644116) has the molecular formula C10H17NO3S2 and a molecular weight of 263.38 g/mol. Its IUPAC name is 3-(3-methylsulfonylthiomorpholin-4-yl)cyclopentan-1-one.
| Compound Name | 3-(3-methylsulfonylthiomorpholin-4-yl)cyclopentan-1-one |
|---|---|
| PubChem CID | 79644116 |
| Molecular Formula | C10H17NO3S2 |
| Molecular Weight | 263.38 g/mol |
| Exact Mass | 263.06 |
| IUPAC Name | 3-(3-methylsulfonylthiomorpholin-4-yl)cyclopentan-1-one |
| SMILES | CS(=O)(=O)C1CSCCN1C1CCC(=O)C1 |
| InChI | InChI=1S/C10H17NO3S2/c1-16(13,14)10-7-15-5-4-11(10)8-2-3-9(12)6-8/h8,10H,2-7H2,1H3 |
| InChIKey | VVLPKSJQHSOUDQ-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.38 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |