C11H21N3O2S2 — CID 66384795
N'-cyclopentyl-3-methylsulfonylthiomorpholine-4-carboximidamide (PubChem CID 66384795) has the molecular formula C11H21N3O2S2 and a molecular weight of 291.44 g/mol. Its IUPAC name is N'-cyclopentyl-3-methylsulfonylthiomorpholine-4-carboximidamide.
| Compound Name | N'-cyclopentyl-3-methylsulfonylthiomorpholine-4-carboximidamide |
|---|---|
| PubChem CID | 66384795 |
| Molecular Formula | C11H21N3O2S2 |
| Molecular Weight | 291.44 g/mol |
| Exact Mass | 291.11 |
| IUPAC Name | N'-cyclopentyl-3-methylsulfonylthiomorpholine-4-carboximidamide |
| SMILES | CS(=O)(=O)C1CSCCN1/C(N)=N/C1CCCC1 |
| InChI | InChI=1S/C11H21N3O2S2/c1-18(15,16)10-8-17-7-6-14(10)11(12)13-9-4-2-3-5-9/h9-10H,2-8H2,1H3,(H2,12,13) |
| InChIKey | IXIFBCKOGOYVBW-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 75.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.44 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|