About trans-(1R,2R)-2-(3-methylsulfonylthiomorpholin-4-yl)cyclopentan-1-ol
trans-(1R,2R)-2-(3-methylsulfonylthiomorpholin-4-yl)cyclopentan-1-ol (PubChem CID 102734831) has the molecular formula C10H19NO3S2
and a molecular weight of 265.40 g/mol. Its IUPAC name is trans-(1R,2R)-2-(3-methylsulfonylthiomorpholin-4-yl)cyclopentan-1-ol.
Molecular Properties
| Compound Name | trans-(1R,2R)-2-(3-methylsulfonylthiomorpholin-4-yl)cyclopentan-1-ol |
| PubChem CID | 102734831 |
| Molecular Formula | C10H19NO3S2 |
| Molecular Weight | 265.40 g/mol |
| Exact Mass | 265.08 |
| IUPAC Name | trans-(1R,2R)-2-(3-methylsulfonylthiomorpholin-4-yl)cyclopentan-1-ol |
| SMILES | CS(=O)(=O)C1CSCCN1[C@@H]1CCC[C@H]1O |
| InChI | InChI=1S/C10H19NO3S2/c1-16(13,14)10-7-15-6-5-11(10)8-3-2-4-9(8)12/h8-10,12H,2-7H2,1H3/t8-,9-,10?/m1/s1 |
| InChIKey | NMVIWEQBGCPKEK-MGRQHWMJSA-N |
| XLogP | 0.32 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.40 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze trans-(1R,2R)-2-(3-methylsulfonylthiomorpholin-4-yl)cyclopentan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trans-(1R,2R)-2-(3-methylsulfonylthiomorpholin-4-yl)cyclopentan-1-ol?
The IUPAC name of trans-(1R,2R)-2-(3-methylsulfonylthiomorpholin-4-yl)cyclopentan-1-ol (CID 102734831) is trans-(1R,2R)-2-(3-methylsulfonylthiomorpholin-4-yl)cyclopentan-1-ol.
What is the SMILES notation for trans-(1R,2R)-2-(3-methylsulfonylthiomorpholin-4-yl)cyclopentan-1-ol?
The canonical SMILES for trans-(1R,2R)-2-(3-methylsulfonylthiomorpholin-4-yl)cyclopentan-1-ol is CS(=O)(=O)C1CSCCN1[C@@H]1CCC[C@H]1O.
What is the InChIKey of trans-(1R,2R)-2-(3-methylsulfonylthiomorpholin-4-yl)cyclopentan-1-ol?
The InChIKey is NMVIWEQBGCPKEK-MGRQHWMJSA-N. The full InChI is InChI=1S/C10H19NO3S2/c1-16(13,14)10-7-15-6-5-11(10)8-3-2-4-9(8)12/h8-10,12H,2-7H2,1H3/t8-,9-,10?/m1/s1.
What are the key properties of trans-(1R,2R)-2-(3-methylsulfonylthiomorpholin-4-yl)cyclopentan-1-ol?
trans-(1R,2R)-2-(3-methylsulfonylthiomorpholin-4-yl)cyclopentan-1-ol has a molecular weight of 265.40 g/mol, XLogP of 0.32, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for trans-(1R,2R)-2-(3-methylsulfonylthiomorpholin-4-yl)cyclopentan-1-ol is sourced from PubChem (CID 102734831), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).