C14H26N6O — CID 81007097
N-butan-2-yl-3-[(2-ethyl-6-hydrazinyl-5-methylpyrimidin-4-yl)amino]propanamide (PubChem CID 81007097) has the molecular formula C14H26N6O and a molecular weight of 294.40 g/mol. Its IUPAC name is N-butan-2-yl-3-[(2-ethyl-6-hydrazinyl-5-methylpyrimidin-4-yl)amino]propanamide.
| Compound Name | N-butan-2-yl-3-[(2-ethyl-6-hydrazinyl-5-methylpyrimidin-4-yl)amino]propanamide |
|---|---|
| PubChem CID | 81007097 |
| Molecular Formula | C14H26N6O |
| Molecular Weight | 294.40 g/mol |
| Exact Mass | 294.22 |
| IUPAC Name | N-butan-2-yl-3-[(2-ethyl-6-hydrazinyl-5-methylpyrimidin-4-yl)amino]propanamide |
| SMILES | CCc1nc(NN)c(C)c(NCCC(=O)NC(C)CC)n1 |
| InChI | InChI=1S/C14H26N6O/c1-5-9(3)17-12(21)7-8-16-13-10(4)14(20-15)19-11(6-2)18-13/h9H,5-8,15H2,1-4H3,(H,17,21)(H2,16,18,19,20) |
| InChIKey | VGSSFIVPRDXNDJ-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 104.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.40 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|