C11H23N — CID 81016533
N,2,3-trimethyl-5-methylideneheptan-1-amine (PubChem CID 81016533) has the molecular formula C11H23N and a molecular weight of 169.31 g/mol. Its IUPAC name is N,2,3-trimethyl-5-methylideneheptan-1-amine.
| Compound Name | N,2,3-trimethyl-5-methylideneheptan-1-amine |
|---|---|
| PubChem CID | 81016533 |
| Molecular Formula | C11H23N |
| Molecular Weight | 169.31 g/mol |
| Exact Mass | 169.18 |
| IUPAC Name | N,2,3-trimethyl-5-methylideneheptan-1-amine |
| SMILES | C=C(CC)CC(C)C(C)CNC |
| InChI | InChI=1S/C11H23N/c1-6-9(2)7-10(3)11(4)8-12-5/h10-12H,2,6-8H2,1,3-5H3 |
| InChIKey | KMNMXZMTICDCBD-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.31 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|