C13H24O2 — CID 81020356
2-butan-2-yl-4,4-dimethylcyclohexane-1-carboxylic acid (PubChem CID 81020356) has the molecular formula C13H24O2 and a molecular weight of 212.33 g/mol. Its IUPAC name is 2-butan-2-yl-4,4-dimethylcyclohexane-1-carboxylic acid.
| Compound Name | 2-butan-2-yl-4,4-dimethylcyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 81020356 |
| Molecular Formula | C13H24O2 |
| Molecular Weight | 212.33 g/mol |
| Exact Mass | 212.18 |
| IUPAC Name | 2-butan-2-yl-4,4-dimethylcyclohexane-1-carboxylic acid |
| SMILES | CCC(C)C1CC(C)(C)CCC1C(=O)O |
| InChI | InChI=1S/C13H24O2/c1-5-9(2)11-8-13(3,4)7-6-10(11)12(14)15/h9-11H,5-8H2,1-4H3,(H,14,15) |
| InChIKey | DWWXHXKSSJNWLM-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.33 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |