C15H28O2 — CID 81021000
2-hexyl-4,4-dimethylcyclohexane-1-carboxylic acid (PubChem CID 81021000) has the molecular formula C15H28O2 and a molecular weight of 240.39 g/mol. Its IUPAC name is 2-hexyl-4,4-dimethylcyclohexane-1-carboxylic acid.
| Compound Name | 2-hexyl-4,4-dimethylcyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 81021000 |
| Molecular Formula | C15H28O2 |
| Molecular Weight | 240.39 g/mol |
| Exact Mass | 240.21 |
| IUPAC Name | 2-hexyl-4,4-dimethylcyclohexane-1-carboxylic acid |
| SMILES | CCCCCCC1CC(C)(C)CCC1C(=O)O |
| InChI | InChI=1S/C15H28O2/c1-4-5-6-7-8-12-11-15(2,3)10-9-13(12)14(16)17/h12-13H,4-11H2,1-3H3,(H,16,17) |
| InChIKey | CMWDWQAEMVUZCP-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.39 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|