C14H17NO2S — CID 81039242
N-[(1,1-dioxothiolan-2-yl)methyl]-3-phenylprop-2-yn-1-amine (PubChem CID 81039242) has the molecular formula C14H17NO2S and a molecular weight of 263.36 g/mol. Its IUPAC name is N-[(1,1-dioxothiolan-2-yl)methyl]-3-phenylprop-2-yn-1-amine.
| Compound Name | N-[(1,1-dioxothiolan-2-yl)methyl]-3-phenylprop-2-yn-1-amine |
|---|---|
| PubChem CID | 81039242 |
| Molecular Formula | C14H17NO2S |
| Molecular Weight | 263.36 g/mol |
| Exact Mass | 263.10 |
| IUPAC Name | N-[(1,1-dioxothiolan-2-yl)methyl]-3-phenylprop-2-yn-1-amine |
| SMILES | O=S1(=O)CCCC1CNCC#Cc1ccccc1 |
| InChI | InChI=1S/C14H17NO2S/c16-18(17)11-5-9-14(18)12-15-10-4-8-13-6-2-1-3-7-13/h1-3,6-7,14-15H,5,9-12H2 |
| InChIKey | FPRRUMLPMVBKJC-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.36 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|