C12H18N2O3S — CID 82897488
1-[2-[(1,1-dioxothiolan-2-yl)methylamino]ethyl]pyridin-2-one (PubChem CID 82897488) has the molecular formula C12H18N2O3S and a molecular weight of 270.35 g/mol. Its IUPAC name is 1-[2-[(1,1-dioxothiolan-2-yl)methylamino]ethyl]pyridin-2-one.
| Compound Name | 1-[2-[(1,1-dioxothiolan-2-yl)methylamino]ethyl]pyridin-2-one |
|---|---|
| PubChem CID | 82897488 |
| Molecular Formula | C12H18N2O3S |
| Molecular Weight | 270.35 g/mol |
| Exact Mass | 270.10 |
| IUPAC Name | 1-[2-[(1,1-dioxothiolan-2-yl)methylamino]ethyl]pyridin-2-one |
| SMILES | O=c1ccccn1CCNCC1CCCS1(=O)=O |
| InChI | InChI=1S/C12H18N2O3S/c15-12-5-1-2-7-14(12)8-6-13-10-11-4-3-9-18(11,16)17/h1-2,5,7,11,13H,3-4,6,8-10H2 |
| InChIKey | TYHICWQFZGQLON-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 68.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.35 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|