C12H14ClN3O2S — CID 81040515
5-chloro-1-[(1,1-dioxothiolan-2-yl)methyl]benzimidazol-2-amine (PubChem CID 81040515) has the molecular formula C12H14ClN3O2S and a molecular weight of 299.78 g/mol. Its IUPAC name is 5-chloro-1-[(1,1-dioxothiolan-2-yl)methyl]benzimidazol-2-amine.
| Compound Name | 5-chloro-1-[(1,1-dioxothiolan-2-yl)methyl]benzimidazol-2-amine |
|---|---|
| PubChem CID | 81040515 |
| Molecular Formula | C12H14ClN3O2S |
| Molecular Weight | 299.78 g/mol |
| Exact Mass | 299.05 |
| IUPAC Name | 5-chloro-1-[(1,1-dioxothiolan-2-yl)methyl]benzimidazol-2-amine |
| SMILES | Nc1nc2cc(Cl)ccc2n1CC1CCCS1(=O)=O |
| InChI | InChI=1S/C12H14ClN3O2S/c13-8-3-4-11-10(6-8)15-12(14)16(11)7-9-2-1-5-19(9,17)18/h3-4,6,9H,1-2,5,7H2,(H2,14,15) |
| InChIKey | SOWSTUZGEOKXMC-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 77.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.78 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |