C13H17N3 — CID 81041853
2,6-dimethyl-4-piperidin-1-ylpyridine-3-carbonitrile (PubChem CID 81041853) has the molecular formula C13H17N3 and a molecular weight of 215.30 g/mol. Its IUPAC name is 2,6-dimethyl-4-piperidin-1-ylpyridine-3-carbonitrile.
| Compound Name | 2,6-dimethyl-4-piperidin-1-ylpyridine-3-carbonitrile |
|---|---|
| PubChem CID | 81041853 |
| Molecular Formula | C13H17N3 |
| Molecular Weight | 215.30 g/mol |
| Exact Mass | 215.14 |
| IUPAC Name | 2,6-dimethyl-4-piperidin-1-ylpyridine-3-carbonitrile |
| SMILES | Cc1cc(N2CCCCC2)c(C#N)c(C)n1 |
| InChI | InChI=1S/C13H17N3/c1-10-8-13(12(9-14)11(2)15-10)16-6-4-3-5-7-16/h8H,3-7H2,1-2H3 |
| InChIKey | WCZPETLUHAQJCW-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 39.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.30 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |