C13H18N4OS — CID 81054010
2,6-dimethyl-4-(4-methyl-3-oxopiperazin-1-yl)pyridine-3-carbothioamide (PubChem CID 81054010) has the molecular formula C13H18N4OS and a molecular weight of 278.38 g/mol. Its IUPAC name is 2,6-dimethyl-4-(4-methyl-3-oxopiperazin-1-yl)pyridine-3-carbothioamide.
| Compound Name | 2,6-dimethyl-4-(4-methyl-3-oxopiperazin-1-yl)pyridine-3-carbothioamide |
|---|---|
| PubChem CID | 81054010 |
| Molecular Formula | C13H18N4OS |
| Molecular Weight | 278.38 g/mol |
| Exact Mass | 278.12 |
| IUPAC Name | 2,6-dimethyl-4-(4-methyl-3-oxopiperazin-1-yl)pyridine-3-carbothioamide |
| SMILES | Cc1cc(N2CCN(C)C(=O)C2)c(C(N)=S)c(C)n1 |
| InChI | InChI=1S/C13H18N4OS/c1-8-6-10(12(13(14)19)9(2)15-8)17-5-4-16(3)11(18)7-17/h6H,4-5,7H2,1-3H3,(H2,14,19) |
| InChIKey | URRIYQJFKDIXGY-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 62.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.38 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|