C11H19BrN2O3S2 — CID 81068902
5-(aminomethyl)-2-bromo-N-methyl-N-(2-propan-2-yloxyethyl)thiophene-3-sulfonamide (PubChem CID 81068902) has the molecular formula C11H19BrN2O3S2 and a molecular weight of 371.32 g/mol. Its IUPAC name is 5-(aminomethyl)-2-bromo-N-methyl-N-(2-propan-2-yloxyethyl)thiophene-3-sulfonamide.
| Compound Name | 5-(aminomethyl)-2-bromo-N-methyl-N-(2-propan-2-yloxyethyl)thiophene-3-sulfonamide |
|---|---|
| PubChem CID | 81068902 |
| Molecular Formula | C11H19BrN2O3S2 |
| Molecular Weight | 371.32 g/mol |
| Exact Mass | 370.00 |
| IUPAC Name | 5-(aminomethyl)-2-bromo-N-methyl-N-(2-propan-2-yloxyethyl)thiophene-3-sulfonamide |
| SMILES | CC(C)OCCN(C)S(=O)(=O)c1cc(CN)sc1Br |
| InChI | InChI=1S/C11H19BrN2O3S2/c1-8(2)17-5-4-14(3)19(15,16)10-6-9(7-13)18-11(10)12/h6,8H,4-5,7,13H2,1-3H3 |
| InChIKey | QHESOAQNGYSKGW-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.32 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |