3-[(1,4-dioxan-2-ylmethylcarbamoylamino)methyl]pentanoic acid

C12H22N2O5 — CID 81069548

IUPAC3-[(1,4-dioxan-2-ylmethylcarbamoylamino)methyl]pentanoic acid
SMILESCCC(CNC(=O)NCC1COCCO1)CC(=O)O
InChIInChI=1S/C12H22N2O5/c1-2-9(5-11(15)16)6-13-12(17)14-7-10-8-18-3-4-19-10/h9-10H,2-8H2,1H3,(H,15,16)(H2,13,14,17)
InChIKeyWODSTVBIHODIDD-UHFFFAOYSA-N
MW274.32 g/mol
LogP0.20
Rot. Bonds7

About 3-[(1,4-dioxan-2-ylmethylcarbamoylamino)methyl]pentanoic acid

3-[(1,4-dioxan-2-ylmethylcarbamoylamino)methyl]pentanoic acid (PubChem CID 81069548) has the molecular formula C12H22N2O5 and a molecular weight of 274.32 g/mol. Its IUPAC name is 3-[(1,4-dioxan-2-ylmethylcarbamoylamino)methyl]pentanoic acid.

Molecular Properties

Compound Name3-[(1,4-dioxan-2-ylmethylcarbamoylamino)methyl]pentanoic acid
PubChem CID81069548
Molecular FormulaC12H22N2O5
Molecular Weight274.32 g/mol
Exact Mass274.15
IUPAC Name3-[(1,4-dioxan-2-ylmethylcarbamoylamino)methyl]pentanoic acid
SMILESCCC(CNC(=O)NCC1COCCO1)CC(=O)O
InChIInChI=1S/C12H22N2O5/c1-2-9(5-11(15)16)6-13-12(17)14-7-10-8-18-3-4-19-10/h9-10H,2-8H2,1H3,(H,15,16)(H2,13,14,17)
InChIKeyWODSTVBIHODIDD-UHFFFAOYSA-N
XLogP0.20
TPSA96.89 Ų
H-Bond Donors3
H-Bond Acceptors4
Rotatable Bonds7
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500274.32
LogP ≤ 50.20
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 104

Analyze 3-[(1,4-dioxan-2-ylmethylcarbamoylamino)methyl]pentanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-[(1,4-dioxan-2-ylmethylcarbamoylamino)methyl]pentanoic acid?
The IUPAC name of 3-[(1,4-dioxan-2-ylmethylcarbamoylamino)methyl]pentanoic acid (CID 81069548) is 3-[(1,4-dioxan-2-ylmethylcarbamoylamino)methyl]pentanoic acid.
What is the SMILES notation for 3-[(1,4-dioxan-2-ylmethylcarbamoylamino)methyl]pentanoic acid?
The canonical SMILES for 3-[(1,4-dioxan-2-ylmethylcarbamoylamino)methyl]pentanoic acid is CCC(CNC(=O)NCC1COCCO1)CC(=O)O.
What is the InChIKey of 3-[(1,4-dioxan-2-ylmethylcarbamoylamino)methyl]pentanoic acid?
The InChIKey is WODSTVBIHODIDD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22N2O5/c1-2-9(5-11(15)16)6-13-12(17)14-7-10-8-18-3-4-19-10/h9-10H,2-8H2,1H3,(H,15,16)(H2,13,14,17).
What are the key properties of 3-[(1,4-dioxan-2-ylmethylcarbamoylamino)methyl]pentanoic acid?
3-[(1,4-dioxan-2-ylmethylcarbamoylamino)methyl]pentanoic acid has a molecular weight of 274.32 g/mol, XLogP of 0.20, 7 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(1,4-dioxan-2-ylmethylcarbamoylamino)methyl]pentanoic acid is sourced from PubChem (CID 81069548), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).