C11H15N3O4 — CID 81078326
2-[(3-carbamoyl-6-methyl-2-pyridinyl)amino]-3-methoxypropanoic acid (PubChem CID 81078326) has the molecular formula C11H15N3O4 and a molecular weight of 253.26 g/mol. Its IUPAC name is 2-[(3-carbamoyl-6-methyl-2-pyridinyl)amino]-3-methoxypropanoic acid.
| Compound Name | 2-[(3-carbamoyl-6-methyl-2-pyridinyl)amino]-3-methoxypropanoic acid |
|---|---|
| PubChem CID | 81078326 |
| Molecular Formula | C11H15N3O4 |
| Molecular Weight | 253.26 g/mol |
| Exact Mass | 253.11 |
| IUPAC Name | 2-[(3-carbamoyl-6-methyl-2-pyridinyl)amino]-3-methoxypropanoic acid |
| SMILES | COCC(Nc1nc(C)ccc1C(N)=O)C(=O)O |
| InChI | InChI=1S/C11H15N3O4/c1-6-3-4-7(9(12)15)10(13-6)14-8(5-18-2)11(16)17/h3-4,8H,5H2,1-2H3,(H2,12,15)(H,13,14)(H,16,17) |
| InChIKey | OCBFAFSYSCRULB-UHFFFAOYSA-N |
| XLogP | 0.00 |
| TPSA | 114.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.26 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |