C13H13N3O3S — CID 115284584
2-[(3-carbamoyl-6-methyl-2-pyridinyl)amino]-2-thiophen-2-ylacetic acid (PubChem CID 115284584) has the molecular formula C13H13N3O3S and a molecular weight of 291.33 g/mol. Its IUPAC name is 2-[(3-carbamoyl-6-methyl-2-pyridinyl)amino]-2-thiophen-2-ylacetic acid.
| Compound Name | 2-[(3-carbamoyl-6-methyl-2-pyridinyl)amino]-2-thiophen-2-ylacetic acid |
|---|---|
| PubChem CID | 115284584 |
| Molecular Formula | C13H13N3O3S |
| Molecular Weight | 291.33 g/mol |
| Exact Mass | 291.07 |
| IUPAC Name | 2-[(3-carbamoyl-6-methyl-2-pyridinyl)amino]-2-thiophen-2-ylacetic acid |
| SMILES | Cc1ccc(C(N)=O)c(NC(C(=O)O)c2cccs2)n1 |
| InChI | InChI=1S/C13H13N3O3S/c1-7-4-5-8(11(14)17)12(15-7)16-10(13(18)19)9-3-2-6-20-9/h2-6,10H,1H3,(H2,14,17)(H,15,16)(H,18,19) |
| InChIKey | ICBQBXLRCHYYMC-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 105.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.33 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |